C16H22O4S — CID 10924957
8-[1-(benzenesulfonyl)ethyl]-1,4-dioxaspiro[4.5]decane (PubChem CID 10924957) has the molecular formula C16H22O4S and a molecular weight of 310.41 g/mol. Its IUPAC name is 8-[1-(benzenesulfonyl)ethyl]-1,4-dioxaspiro[4.5]decane.
| Compound Name | 8-[1-(benzenesulfonyl)ethyl]-1,4-dioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 10924957 |
| Molecular Formula | C16H22O4S |
| Molecular Weight | 310.41 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 8-[1-(benzenesulfonyl)ethyl]-1,4-dioxaspiro[4.5]decane |
| SMILES | CC(C1CCC2(CC1)OCCO2)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H22O4S/c1-13(21(17,18)15-5-3-2-4-6-15)14-7-9-16(10-8-14)19-11-12-20-16/h2-6,13-14H,7-12H2,1H3 |
| InChIKey | YRCXVUBKQJOIQL-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.41 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |