C20H26O5S — CID 11337920
6-(benzenesulfonylmethyl)-6-methylspiro[1,2,4-trioxane-3,2'-adamantane] (PubChem CID 11337920) has the molecular formula C20H26O5S and a molecular weight of 378.49 g/mol. Its IUPAC name is 6-(benzenesulfonylmethyl)-6-methylspiro[1,2,4-trioxane-3,2'-adamantane].
| Compound Name | 6-(benzenesulfonylmethyl)-6-methylspiro[1,2,4-trioxane-3,2'-adamantane] |
|---|---|
| PubChem CID | 11337920 |
| Molecular Formula | C20H26O5S |
| Molecular Weight | 378.49 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | 6-(benzenesulfonylmethyl)-6-methylspiro[1,2,4-trioxane-3,2'-adamantane] |
| SMILES | CC1(CS(=O)(=O)c2ccccc2)COC2(OO1)C1CC3CC(C1)CC2C3 |
| InChI | InChI=1S/C20H26O5S/c1-19(13-26(21,22)18-5-3-2-4-6-18)12-23-20(25-24-19)16-8-14-7-15(10-16)11-17(20)9-14/h2-6,14-17H,7-13H2,1H3 |
| InChIKey | NVDSNXGQMHWLBF-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.49 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|