C19H28O2S — CID 11186293
(5R)-2,2,4,4-tetramethyl-5-[(E)-3-methyl-5-phenylsulfanylpent-3-enyl]-1,3-dioxolane (PubChem CID 11186293) has the molecular formula C19H28O2S and a molecular weight of 320.50 g/mol. Its IUPAC name is (5R)-2,2,4,4-tetramethyl-5-[(E)-3-methyl-5-phenylsulfanylpent-3-enyl]-1,3-dioxolane.
| Compound Name | (5R)-2,2,4,4-tetramethyl-5-[(E)-3-methyl-5-phenylsulfanylpent-3-enyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 11186293 |
| Molecular Formula | C19H28O2S |
| Molecular Weight | 320.50 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | (5R)-2,2,4,4-tetramethyl-5-[(E)-3-methyl-5-phenylsulfanylpent-3-enyl]-1,3-dioxolane |
| SMILES | C/C(=C\CSc1ccccc1)CC[C@H]1OC(C)(C)OC1(C)C |
| InChI | InChI=1S/C19H28O2S/c1-15(13-14-22-16-9-7-6-8-10-16)11-12-17-18(2,3)21-19(4,5)20-17/h6-10,13,17H,11-12,14H2,1-5H3/b15-13+/t17-/m1/s1 |
| InChIKey | UUFPKMSRKMKOPV-LCJXNMAOSA-N |
| XLogP | 5.44 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.50 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|