C18H24O3S — CID 11823373
3-[(4S,5S)-2,2-dimethyl-5-(2-methyl-1-phenylsulfanylpropan-2-yl)-1,3-dioxolan-4-yl]prop-2-yn-1-ol (PubChem CID 11823373) has the molecular formula C18H24O3S and a molecular weight of 320.45 g/mol. Its IUPAC name is 3-[(4S,5S)-2,2-dimethyl-5-(2-methyl-1-phenylsulfanylpropan-2-yl)-1,3-dioxolan-4-yl]prop-2-yn-1-ol.
| Compound Name | 3-[(4S,5S)-2,2-dimethyl-5-(2-methyl-1-phenylsulfanylpropan-2-yl)-1,3-dioxolan-4-yl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 11823373 |
| Molecular Formula | C18H24O3S |
| Molecular Weight | 320.45 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 3-[(4S,5S)-2,2-dimethyl-5-(2-methyl-1-phenylsulfanylpropan-2-yl)-1,3-dioxolan-4-yl]prop-2-yn-1-ol |
| SMILES | CC1(C)O[C@@H](C#CCO)[C@H](C(C)(C)CSc2ccccc2)O1 |
| InChI | InChI=1S/C18H24O3S/c1-17(2,13-22-14-9-6-5-7-10-14)16-15(11-8-12-19)20-18(3,4)21-16/h5-7,9-10,15-16,19H,12-13H2,1-4H3/t15-,16+/m0/s1 |
| InChIKey | ZCFOPWCKBYDTFB-JKSUJKDBSA-N |
| XLogP | 3.32 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.45 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|