C18H28O2S — CID 10566781
4-hexyl-2,2-dimethyl-6-phenylsulfanyl-1,3-dioxane (PubChem CID 10566781) has the molecular formula C18H28O2S and a molecular weight of 308.49 g/mol. Its IUPAC name is 4-hexyl-2,2-dimethyl-6-phenylsulfanyl-1,3-dioxane.
| Compound Name | 4-hexyl-2,2-dimethyl-6-phenylsulfanyl-1,3-dioxane |
|---|---|
| PubChem CID | 10566781 |
| Molecular Formula | C18H28O2S |
| Molecular Weight | 308.49 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | 4-hexyl-2,2-dimethyl-6-phenylsulfanyl-1,3-dioxane |
| SMILES | CCCCCCC1CC(Sc2ccccc2)OC(C)(C)O1 |
| InChI | InChI=1S/C18H28O2S/c1-4-5-6-8-11-15-14-17(20-18(2,3)19-15)21-16-12-9-7-10-13-16/h7,9-10,12-13,15,17H,4-6,8,11,14H2,1-3H3 |
| InChIKey | VOIDSOMJFXZHGO-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.49 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|