C18H28O2S — CID 10733630
(2S,4S,5S)-4-hexyl-2,5-dimethyl-6-phenylsulfanyl-1,3-dioxane (PubChem CID 10733630) has the molecular formula C18H28O2S and a molecular weight of 308.49 g/mol. Its IUPAC name is (2S,4S,5S)-4-hexyl-2,5-dimethyl-6-phenylsulfanyl-1,3-dioxane.
| Compound Name | (2S,4S,5S)-4-hexyl-2,5-dimethyl-6-phenylsulfanyl-1,3-dioxane |
|---|---|
| PubChem CID | 10733630 |
| Molecular Formula | C18H28O2S |
| Molecular Weight | 308.49 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | (2S,4S,5S)-4-hexyl-2,5-dimethyl-6-phenylsulfanyl-1,3-dioxane |
| SMILES | CCCCCC[C@@H]1O[C@H](C)OC(Sc2ccccc2)[C@H]1C |
| InChI | InChI=1S/C18H28O2S/c1-4-5-6-10-13-17-14(2)18(20-15(3)19-17)21-16-11-8-7-9-12-16/h7-9,11-12,14-15,17-18H,4-6,10,13H2,1-3H3/t14-,15-,17-,18?/m0/s1 |
| InChIKey | NWTGAHQHSNJSLW-CFDUMUSFSA-N |
| XLogP | 5.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.49 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|