C31H44O2S2 — CID 14106308
(2R,4S,8R,11S)-8-methyl-2,4-bis(3-phenylsulfanylpropyl)-11-propan-2-yl-1,5-dioxaspiro[5.5]undecane (PubChem CID 14106308) has the molecular formula C31H44O2S2 and a molecular weight of 512.83 g/mol. Its IUPAC name is (2R,4S,8R,11S)-8-methyl-2,4-bis(3-phenylsulfanylpropyl)-11-propan-2-yl-1,5-dioxaspiro[5.5]undecane.
| Compound Name | (2R,4S,8R,11S)-8-methyl-2,4-bis(3-phenylsulfanylpropyl)-11-propan-2-yl-1,5-dioxaspiro[5.5]undecane |
|---|---|
| PubChem CID | 14106308 |
| Molecular Formula | C31H44O2S2 |
| Molecular Weight | 512.83 g/mol |
| Exact Mass | 512.28 |
| IUPAC Name | (2R,4S,8R,11S)-8-methyl-2,4-bis(3-phenylsulfanylpropyl)-11-propan-2-yl-1,5-dioxaspiro[5.5]undecane |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)CC12O[C@H](CCCSc1ccccc1)C[C@H](CCCSc1ccccc1)O2 |
| InChI | InChI=1S/C31H44O2S2/c1-24(2)30-19-18-25(3)23-31(30)32-26(12-10-20-34-28-14-6-4-7-15-28)22-27(33-31)13-11-21-35-29-16-8-5-9-17-29/h4-9,14-17,24-27,30H,10-13,18-23H2,1-3H3/t25-,26-,27+,30+,31?/m1/s1 |
| InChIKey | AWSJOQXTVMVRPB-ITYMSGGNSA-N |
| XLogP | 9.09 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.83 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|