About (5-methyl-2-propan-2-ylcyclohexyl) 2-phenylsulfanylacetate
(5-methyl-2-propan-2-ylcyclohexyl) 2-phenylsulfanylacetate (PubChem CID 176904323) has the molecular formula C18H26O2S
and a molecular weight of 306.47 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl) 2-phenylsulfanylacetate.
Molecular Properties
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl) 2-phenylsulfanylacetate |
| PubChem CID | 176904323 |
| Molecular Formula | C18H26O2S |
| Molecular Weight | 306.47 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl) 2-phenylsulfanylacetate |
| SMILES | CC1CCC(C(C)C)C(OC(=O)CSc2ccccc2)C1 |
| InChI | InChI=1S/C18H26O2S/c1-13(2)16-10-9-14(3)11-17(16)20-18(19)12-21-15-7-5-4-6-8-15/h4-8,13-14,16-17H,9-12H2,1-3H3 |
| InChIKey | FUWJRNSYBBTJPX-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.47 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5-methyl-2-propan-2-ylcyclohexyl) 2-phenylsulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methyl-2-propan-2-ylcyclohexyl) 2-phenylsulfanylacetate?
The IUPAC name of (5-methyl-2-propan-2-ylcyclohexyl) 2-phenylsulfanylacetate (CID 176904323) is (5-methyl-2-propan-2-ylcyclohexyl) 2-phenylsulfanylacetate.
What is the SMILES notation for (5-methyl-2-propan-2-ylcyclohexyl) 2-phenylsulfanylacetate?
The canonical SMILES for (5-methyl-2-propan-2-ylcyclohexyl) 2-phenylsulfanylacetate is CC1CCC(C(C)C)C(OC(=O)CSc2ccccc2)C1.
What is the InChIKey of (5-methyl-2-propan-2-ylcyclohexyl) 2-phenylsulfanylacetate?
The InChIKey is FUWJRNSYBBTJPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26O2S/c1-13(2)16-10-9-14(3)11-17(16)20-18(19)12-21-15-7-5-4-6-8-15/h4-8,13-14,16-17H,9-12H2,1-3H3.
What are the key properties of (5-methyl-2-propan-2-ylcyclohexyl) 2-phenylsulfanylacetate?
(5-methyl-2-propan-2-ylcyclohexyl) 2-phenylsulfanylacetate has a molecular weight of 306.47 g/mol, XLogP of 4.78, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methyl-2-propan-2-ylcyclohexyl) 2-phenylsulfanylacetate is sourced from PubChem (CID 176904323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).