About 3-phenylpropyl 2-phenylsulfanylacetate
3-phenylpropyl 2-phenylsulfanylacetate (PubChem CID 533055) has the molecular formula C17H18O2S
and a molecular weight of 286.40 g/mol. Its IUPAC name is 3-phenylpropyl 2-phenylsulfanylacetate.
Molecular Properties
| Compound Name | 3-phenylpropyl 2-phenylsulfanylacetate |
| PubChem CID | 533055 |
| Molecular Formula | C17H18O2S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 3-phenylpropyl 2-phenylsulfanylacetate |
| SMILES | O=C(CSc1ccccc1)OCCCc1ccccc1 |
| InChI | InChI=1S/C17H18O2S/c18-17(14-20-16-11-5-2-6-12-16)19-13-7-10-15-8-3-1-4-9-15/h1-6,8-9,11-12H,7,10,13-14H2 |
| InChIKey | FURQRGUDFUEJKS-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-phenylpropyl 2-phenylsulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylpropyl 2-phenylsulfanylacetate?
The IUPAC name of 3-phenylpropyl 2-phenylsulfanylacetate (CID 533055) is 3-phenylpropyl 2-phenylsulfanylacetate.
What is the SMILES notation for 3-phenylpropyl 2-phenylsulfanylacetate?
The canonical SMILES for 3-phenylpropyl 2-phenylsulfanylacetate is O=C(CSc1ccccc1)OCCCc1ccccc1.
What is the InChIKey of 3-phenylpropyl 2-phenylsulfanylacetate?
The InChIKey is FURQRGUDFUEJKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18O2S/c18-17(14-20-16-11-5-2-6-12-16)19-13-7-10-15-8-3-1-4-9-15/h1-6,8-9,11-12H,7,10,13-14H2.
What are the key properties of 3-phenylpropyl 2-phenylsulfanylacetate?
3-phenylpropyl 2-phenylsulfanylacetate has a molecular weight of 286.40 g/mol, XLogP of 3.95, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylpropyl 2-phenylsulfanylacetate is sourced from PubChem (CID 533055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).