C24H29ClO2S — CID 11362062
[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 2-chloro-2-phenylsulfanylacetate (PubChem CID 11362062) has the molecular formula C24H29ClO2S and a molecular weight of 417.01 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 2-chloro-2-phenylsulfanylacetate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 2-chloro-2-phenylsulfanylacetate |
|---|---|
| PubChem CID | 11362062 |
| Molecular Formula | C24H29ClO2S |
| Molecular Weight | 417.01 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 2-chloro-2-phenylsulfanylacetate |
| SMILES | C[C@@H]1CC[C@@H](C(C)(C)c2ccccc2)[C@H](OC(=O)C(Cl)Sc2ccccc2)C1 |
| InChI | InChI=1S/C24H29ClO2S/c1-17-14-15-20(24(2,3)18-10-6-4-7-11-18)21(16-17)27-23(26)22(25)28-19-12-8-5-9-13-19/h4-13,17,20-22H,14-16H2,1-3H3/t17-,20-,21-,22?/m1/s1 |
| InChIKey | GNTQQVKAENICKQ-BRETVVRTSA-N |
| XLogP | 6.67 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.01 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|