C27H34O2S — CID 10862763
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2R,3S)-3-phenyl-2-phenylsulfanylpent-4-enoate (PubChem CID 10862763) has the molecular formula C27H34O2S and a molecular weight of 422.63 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2R,3S)-3-phenyl-2-phenylsulfanylpent-4-enoate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2R,3S)-3-phenyl-2-phenylsulfanylpent-4-enoate |
|---|---|
| PubChem CID | 10862763 |
| Molecular Formula | C27H34O2S |
| Molecular Weight | 422.63 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2R,3S)-3-phenyl-2-phenylsulfanylpent-4-enoate |
| SMILES | C=C[C@@H](c1ccccc1)[C@@H](Sc1ccccc1)C(=O)O[C@@H]1C[C@H](C)CC[C@H]1C(C)C |
| InChI | InChI=1S/C27H34O2S/c1-5-23(21-12-8-6-9-13-21)26(30-22-14-10-7-11-15-22)27(28)29-25-18-20(4)16-17-24(25)19(2)3/h5-15,19-20,23-26H,1,16-18H2,2-4H3/t20-,23+,24+,25-,26-/m1/s1 |
| InChIKey | UNKQXVKGXCZULV-KCQKKKKCSA-N |
| XLogP | 7.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.63 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|