C18H25ClO2 — CID 11758658
[(1S,2R,5S)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 2-chloroacetate (PubChem CID 11758658) has the molecular formula C18H25ClO2 and a molecular weight of 308.85 g/mol. Its IUPAC name is [(1S,2R,5S)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 2-chloroacetate.
| Compound Name | [(1S,2R,5S)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 2-chloroacetate |
|---|---|
| PubChem CID | 11758658 |
| Molecular Formula | C18H25ClO2 |
| Molecular Weight | 308.85 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | [(1S,2R,5S)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 2-chloroacetate |
| SMILES | C[C@H]1CC[C@H](C(C)(C)c2ccccc2)[C@@H](OC(=O)CCl)C1 |
| InChI | InChI=1S/C18H25ClO2/c1-13-9-10-15(16(11-13)21-17(20)12-19)18(2,3)14-7-5-4-6-8-14/h4-8,13,15-16H,9-12H2,1-3H3/t13-,15-,16-/m0/s1 |
| InChIKey | GYWWQECFQIGECM-BPUTZDHNSA-N |
| XLogP | 4.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.85 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|