C19H25FO2 — CID 134889249
[(2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 2-fluoroprop-2-enoate (PubChem CID 134889249) has the molecular formula C19H25FO2 and a molecular weight of 304.41 g/mol. Its IUPAC name is [(2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 2-fluoroprop-2-enoate.
| Compound Name | [(2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 2-fluoroprop-2-enoate |
|---|---|
| PubChem CID | 134889249 |
| Molecular Formula | C19H25FO2 |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | [(2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 2-fluoroprop-2-enoate |
| SMILES | C=C(F)C(=O)OC1C[C@H](C)CC[C@H]1C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C19H25FO2/c1-13-10-11-16(17(12-13)22-18(21)14(2)20)19(3,4)15-8-6-5-7-9-15/h5-9,13,16-17H,2,10-12H2,1,3-4H3/t13-,16-,17?/m1/s1 |
| InChIKey | VHRLDYHUGFKDPX-ZIAVVELASA-N |
| XLogP | 4.80 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|