C18H23Cl2FO2 — CID 134877102
[(1R,2S,5R)-2-[2-(4-fluorophenyl)propan-2-yl]-5-methylcyclohexyl] 2,2-dichloroacetate (PubChem CID 134877102) has the molecular formula C18H23Cl2FO2 and a molecular weight of 361.28 g/mol. Its IUPAC name is [(1R,2S,5R)-2-[2-(4-fluorophenyl)propan-2-yl]-5-methylcyclohexyl] 2,2-dichloroacetate.
| Compound Name | [(1R,2S,5R)-2-[2-(4-fluorophenyl)propan-2-yl]-5-methylcyclohexyl] 2,2-dichloroacetate |
|---|---|
| PubChem CID | 134877102 |
| Molecular Formula | C18H23Cl2FO2 |
| Molecular Weight | 361.28 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | [(1R,2S,5R)-2-[2-(4-fluorophenyl)propan-2-yl]-5-methylcyclohexyl] 2,2-dichloroacetate |
| SMILES | C[C@@H]1CC[C@@H](C(C)(C)c2ccc(F)cc2)[C@H](OC(=O)C(Cl)Cl)C1 |
| InChI | InChI=1S/C18H23Cl2FO2/c1-11-4-9-14(15(10-11)23-17(22)16(19)20)18(2,3)12-5-7-13(21)8-6-12/h5-8,11,14-16H,4,9-10H2,1-3H3/t11-,14-,15-/m1/s1 |
| InChIKey | USAZJSFQGNQPNX-KCPJHIHWSA-N |
| XLogP | 5.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.28 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|