About 1-cyclopentylethyl 2-phenylsulfanylacetate
1-cyclopentylethyl 2-phenylsulfanylacetate (PubChem CID 533052) has the molecular formula C15H20O2S
and a molecular weight of 264.39 g/mol. Its IUPAC name is 1-cyclopentylethyl 2-phenylsulfanylacetate.
Molecular Properties
| Compound Name | 1-cyclopentylethyl 2-phenylsulfanylacetate |
| PubChem CID | 533052 |
| Molecular Formula | C15H20O2S |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 1-cyclopentylethyl 2-phenylsulfanylacetate |
| SMILES | CC(OC(=O)CSc1ccccc1)C1CCCC1 |
| InChI | InChI=1S/C15H20O2S/c1-12(13-7-5-6-8-13)17-15(16)11-18-14-9-3-2-4-10-14/h2-4,9-10,12-13H,5-8,11H2,1H3 |
| InChIKey | FSWCJCGGAHDFEM-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-cyclopentylethyl 2-phenylsulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopentylethyl 2-phenylsulfanylacetate?
The IUPAC name of 1-cyclopentylethyl 2-phenylsulfanylacetate (CID 533052) is 1-cyclopentylethyl 2-phenylsulfanylacetate.
What is the SMILES notation for 1-cyclopentylethyl 2-phenylsulfanylacetate?
The canonical SMILES for 1-cyclopentylethyl 2-phenylsulfanylacetate is CC(OC(=O)CSc1ccccc1)C1CCCC1.
What is the InChIKey of 1-cyclopentylethyl 2-phenylsulfanylacetate?
The InChIKey is FSWCJCGGAHDFEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O2S/c1-12(13-7-5-6-8-13)17-15(16)11-18-14-9-3-2-4-10-14/h2-4,9-10,12-13H,5-8,11H2,1H3.
What are the key properties of 1-cyclopentylethyl 2-phenylsulfanylacetate?
1-cyclopentylethyl 2-phenylsulfanylacetate has a molecular weight of 264.39 g/mol, XLogP of 3.90, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopentylethyl 2-phenylsulfanylacetate is sourced from PubChem (CID 533052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).