C13H14O2S — CID 10609754
(3S,3aS,6aS)-3-phenylsulfanyl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 10609754) has the molecular formula C13H14O2S and a molecular weight of 234.32 g/mol. Its IUPAC name is (3S,3aS,6aS)-3-phenylsulfanyl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3S,3aS,6aS)-3-phenylsulfanyl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 10609754 |
| Molecular Formula | C13H14O2S |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | (3S,3aS,6aS)-3-phenylsulfanyl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | O=C1O[C@H]2CCC[C@@H]2[C@@H]1Sc1ccccc1 |
| InChI | InChI=1S/C13H14O2S/c14-13-12(10-7-4-8-11(10)15-13)16-9-5-2-1-3-6-9/h1-3,5-6,10-12H,4,7-8H2/t10-,11-,12-/m0/s1 |
| InChIKey | LHVRINJTNXVOIY-SRVKXCTJSA-N |
| XLogP | 2.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |