C14H16O2S — CID 12510756
(3aS,7R,7aR)-7-phenylsulfanyl-3a,4,5,6,7,7a-hexahydro-3H-1-benzofuran-2-one (PubChem CID 12510756) has the molecular formula C14H16O2S and a molecular weight of 248.35 g/mol. Its IUPAC name is (3aS,7R,7aR)-7-phenylsulfanyl-3a,4,5,6,7,7a-hexahydro-3H-1-benzofuran-2-one.
| Compound Name | (3aS,7R,7aR)-7-phenylsulfanyl-3a,4,5,6,7,7a-hexahydro-3H-1-benzofuran-2-one |
|---|---|
| PubChem CID | 12510756 |
| Molecular Formula | C14H16O2S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | (3aS,7R,7aR)-7-phenylsulfanyl-3a,4,5,6,7,7a-hexahydro-3H-1-benzofuran-2-one |
| SMILES | O=C1C[C@@H]2CCC[C@@H](Sc3ccccc3)[C@@H]2O1 |
| InChI | InChI=1S/C14H16O2S/c15-13-9-10-5-4-8-12(14(10)16-13)17-11-6-2-1-3-7-11/h1-3,6-7,10,12,14H,4-5,8-9H2/t10-,12+,14+/m0/s1 |
| InChIKey | IMFNGRJYEZOKTF-ZKYQVNSYSA-N |
| XLogP | 3.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |