C17H23FO2S — CID 86596146
ethyl 2-[(4-fluorophenyl)sulfanylmethyl]-5-methylcyclohexane-1-carboxylate (PubChem CID 86596146) has the molecular formula C17H23FO2S and a molecular weight of 310.43 g/mol. Its IUPAC name is ethyl 2-[(4-fluorophenyl)sulfanylmethyl]-5-methylcyclohexane-1-carboxylate.
| Compound Name | ethyl 2-[(4-fluorophenyl)sulfanylmethyl]-5-methylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 86596146 |
| Molecular Formula | C17H23FO2S |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | ethyl 2-[(4-fluorophenyl)sulfanylmethyl]-5-methylcyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1CC(C)CCC1CSc1ccc(F)cc1 |
| InChI | InChI=1S/C17H23FO2S/c1-3-20-17(19)16-10-12(2)4-5-13(16)11-21-15-8-6-14(18)7-9-15/h6-9,12-13,16H,3-5,10-11H2,1-2H3 |
| InChIKey | NFFCLVGPFMVQAO-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |