C27H34O3S2 — CID 56849997
(4R,5R)-4-[bis(phenylsulfanyl)methyl]-5-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyoxolan-2-one (PubChem CID 56849997) has the molecular formula C27H34O3S2 and a molecular weight of 470.70 g/mol. Its IUPAC name is (4R,5R)-4-[bis(phenylsulfanyl)methyl]-5-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyoxolan-2-one.
| Compound Name | (4R,5R)-4-[bis(phenylsulfanyl)methyl]-5-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyoxolan-2-one |
|---|---|
| PubChem CID | 56849997 |
| Molecular Formula | C27H34O3S2 |
| Molecular Weight | 470.70 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | (4R,5R)-4-[bis(phenylsulfanyl)methyl]-5-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyoxolan-2-one |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1O[C@@H]1OC(=O)C[C@H]1C(Sc1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C27H34O3S2/c1-18(2)22-15-14-19(3)16-24(22)29-26-23(17-25(28)30-26)27(31-20-10-6-4-7-11-20)32-21-12-8-5-9-13-21/h4-13,18-19,22-24,26-27H,14-17H2,1-3H3/t19-,22+,23-,24-,26-/m1/s1 |
| InChIKey | YHQXOXHIBXBZSZ-JUZSCTAFSA-N |
| XLogP | 7.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.70 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|