C25H22O4S2 — CID 10503736
[(2R,3R)-5-oxo-3-[phenyl-bis(phenylsulfanyl)methyl]oxolan-2-yl] acetate (PubChem CID 10503736) has the molecular formula C25H22O4S2 and a molecular weight of 450.58 g/mol. Its IUPAC name is [(2R,3R)-5-oxo-3-[phenyl-bis(phenylsulfanyl)methyl]oxolan-2-yl] acetate.
| Compound Name | [(2R,3R)-5-oxo-3-[phenyl-bis(phenylsulfanyl)methyl]oxolan-2-yl] acetate |
|---|---|
| PubChem CID | 10503736 |
| Molecular Formula | C25H22O4S2 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | [(2R,3R)-5-oxo-3-[phenyl-bis(phenylsulfanyl)methyl]oxolan-2-yl] acetate |
| SMILES | CC(=O)O[C@@H]1OC(=O)C[C@H]1C(Sc1ccccc1)(Sc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H22O4S2/c1-18(26)28-24-22(17-23(27)29-24)25(19-11-5-2-6-12-19,30-20-13-7-3-8-14-20)31-21-15-9-4-10-16-21/h2-16,22,24H,17H2,1H3/t22-,24-/m1/s1 |
| InChIKey | GRGWBUSIICSIFR-ISKFKSNPSA-N |
| XLogP | 5.88 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|