C33H38O3S2 — CID 10392689
(4R,5R)-5-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-4-[phenyl-bis(phenylsulfanyl)methyl]oxolan-2-one (PubChem CID 10392689) has the molecular formula C33H38O3S2 and a molecular weight of 546.80 g/mol. Its IUPAC name is (4R,5R)-5-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-4-[phenyl-bis(phenylsulfanyl)methyl]oxolan-2-one.
| Compound Name | (4R,5R)-5-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-4-[phenyl-bis(phenylsulfanyl)methyl]oxolan-2-one |
|---|---|
| PubChem CID | 10392689 |
| Molecular Formula | C33H38O3S2 |
| Molecular Weight | 546.80 g/mol |
| Exact Mass | 546.23 |
| IUPAC Name | (4R,5R)-5-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-4-[phenyl-bis(phenylsulfanyl)methyl]oxolan-2-one |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1O[C@@H]1OC(=O)C[C@H]1C(Sc1ccccc1)(Sc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H38O3S2/c1-23(2)28-20-19-24(3)21-30(28)35-32-29(22-31(34)36-32)33(25-13-7-4-8-14-25,37-26-15-9-5-10-16-26)38-27-17-11-6-12-18-27/h4-18,23-24,28-30,32H,19-22H2,1-3H3/t24-,28+,29-,30-,32-/m1/s1 |
| InChIKey | KLVPWKLNDSYCDU-IXXTWTCNSA-N |
| XLogP | 8.79 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.80 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|