C28H30O2S3 — CID 10051448
(4R,5S)-5-pentyl-4-[tris(phenylsulfanyl)methyl]oxolan-2-one (PubChem CID 10051448) has the molecular formula C28H30O2S3 and a molecular weight of 494.75 g/mol. Its IUPAC name is (4R,5S)-5-pentyl-4-[tris(phenylsulfanyl)methyl]oxolan-2-one.
| Compound Name | (4R,5S)-5-pentyl-4-[tris(phenylsulfanyl)methyl]oxolan-2-one |
|---|---|
| PubChem CID | 10051448 |
| Molecular Formula | C28H30O2S3 |
| Molecular Weight | 494.75 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | (4R,5S)-5-pentyl-4-[tris(phenylsulfanyl)methyl]oxolan-2-one |
| SMILES | CCCCC[C@@H]1OC(=O)C[C@H]1C(Sc1ccccc1)(Sc1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C28H30O2S3/c1-2-3-7-20-26-25(21-27(29)30-26)28(31-22-14-8-4-9-15-22,32-23-16-10-5-11-17-23)33-24-18-12-6-13-19-24/h4-6,8-19,25-26H,2-3,7,20-21H2,1H3/t25-,26+/m1/s1 |
| InChIKey | VTODGMLPBZUNKA-FTJBHMTQSA-N |
| XLogP | 8.53 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.75 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|