C35H39FO7S2 — CID 71662197
(3S,6R,7R)-8,8-bis(benzenesulfonyl)-13-fluoro-6-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-5-oxatricyclo[8.4.0.03,7]tetradeca-1(10),11,13-trien-4-one (PubChem CID 71662197) has the molecular formula C35H39FO7S2 and a molecular weight of 654.82 g/mol. Its IUPAC name is (3S,6R,7R)-8,8-bis(benzenesulfonyl)-13-fluoro-6-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-5-oxatricyclo[8.4.0.03,7]tetradeca-1(10),11,13-trien-4-one.
| Compound Name | (3S,6R,7R)-8,8-bis(benzenesulfonyl)-13-fluoro-6-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-5-oxatricyclo[8.4.0.03,7]tetradeca-1(10),11,13-trien-4-one |
|---|---|
| PubChem CID | 71662197 |
| Molecular Formula | C35H39FO7S2 |
| Molecular Weight | 654.82 g/mol |
| Exact Mass | 654.21 |
| IUPAC Name | (3S,6R,7R)-8,8-bis(benzenesulfonyl)-13-fluoro-6-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-5-oxatricyclo[8.4.0.03,7]tetradeca-1(10),11,13-trien-4-one |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1O[C@@H]1OC(=O)[C@H]2Cc3cc(F)ccc3CC(S(=O)(=O)c3ccccc3)(S(=O)(=O)c3ccccc3)[C@@H]12 |
| InChI | InChI=1S/C35H39FO7S2/c1-22(2)29-17-14-23(3)18-31(29)42-34-32-30(33(37)43-34)20-25-19-26(36)16-15-24(25)21-35(32,44(38,39)27-10-6-4-7-11-27)45(40,41)28-12-8-5-9-13-28/h4-13,15-16,19,22-23,29-32,34H,14,17-18,20-21H2,1-3H3/t23-,29+,30+,31-,32-,34-/m1/s1 |
| InChIKey | FBZMDVWTFMWMNT-BZZSZDRRSA-N |
| XLogP | 6.16 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.82 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |