C30H34F2O7S2 — CID 71661287
(3R,3aR)-4,4-bis[(4-fluorophenyl)sulfonyl]-3-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-3,3a,5,6-tetrahydro-2-benzofuran-1-one (PubChem CID 71661287) has the molecular formula C30H34F2O7S2 and a molecular weight of 608.73 g/mol. Its IUPAC name is (3R,3aR)-4,4-bis[(4-fluorophenyl)sulfonyl]-3-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-3,3a,5,6-tetrahydro-2-benzofuran-1-one.
| Compound Name | (3R,3aR)-4,4-bis[(4-fluorophenyl)sulfonyl]-3-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-3,3a,5,6-tetrahydro-2-benzofuran-1-one |
|---|---|
| PubChem CID | 71661287 |
| Molecular Formula | C30H34F2O7S2 |
| Molecular Weight | 608.73 g/mol |
| Exact Mass | 608.17 |
| IUPAC Name | (3R,3aR)-4,4-bis[(4-fluorophenyl)sulfonyl]-3-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-3,3a,5,6-tetrahydro-2-benzofuran-1-one |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1O[C@@H]1OC(=O)C2=CCCC(S(=O)(=O)c3ccc(F)cc3)(S(=O)(=O)c3ccc(F)cc3)[C@H]21 |
| InChI | InChI=1S/C30H34F2O7S2/c1-18(2)24-15-6-19(3)17-26(24)38-29-27-25(28(33)39-29)5-4-16-30(27,40(34,35)22-11-7-20(31)8-12-22)41(36,37)23-13-9-21(32)10-14-23/h5,7-14,18-19,24,26-27,29H,4,6,15-17H2,1-3H3/t19-,24+,26-,27-,29-/m1/s1 |
| InChIKey | OMGXDYRVCKPGSP-SUGSODJJSA-N |
| XLogP | 5.61 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.73 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |