C28H34O5S — CID 59990976
(3R,3aS,9aR)-3a-(benzenesulfonyl)-3-[(1R,3R,5R)-3-methyl-5-propan-2-ylcyclohexyl]oxy-3,4,9,9a-tetrahydrobenzo[f][2]benzofuran-1-one (PubChem CID 59990976) has the molecular formula C28H34O5S and a molecular weight of 482.64 g/mol. Its IUPAC name is (3R,3aS,9aR)-3a-(benzenesulfonyl)-3-[(1R,3R,5R)-3-methyl-5-propan-2-ylcyclohexyl]oxy-3,4,9,9a-tetrahydrobenzo[f][2]benzofuran-1-one.
| Compound Name | (3R,3aS,9aR)-3a-(benzenesulfonyl)-3-[(1R,3R,5R)-3-methyl-5-propan-2-ylcyclohexyl]oxy-3,4,9,9a-tetrahydrobenzo[f][2]benzofuran-1-one |
|---|---|
| PubChem CID | 59990976 |
| Molecular Formula | C28H34O5S |
| Molecular Weight | 482.64 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | (3R,3aS,9aR)-3a-(benzenesulfonyl)-3-[(1R,3R,5R)-3-methyl-5-propan-2-ylcyclohexyl]oxy-3,4,9,9a-tetrahydrobenzo[f][2]benzofuran-1-one |
| SMILES | CC(C)[C@@H]1C[C@@H](C)C[C@@H](O[C@@H]2OC(=O)[C@H]3Cc4ccccc4C[C@@]23S(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C28H34O5S/c1-18(2)22-13-19(3)14-23(15-22)32-27-28(34(30,31)24-11-5-4-6-12-24)17-21-10-8-7-9-20(21)16-25(28)26(29)33-27/h4-12,18-19,22-23,25,27H,13-17H2,1-3H3/t19-,22-,23-,25-,27-,28+/m1/s1 |
| InChIKey | KVPZZFJXQPGYDX-WFKMGBCISA-N |
| XLogP | 4.97 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.64 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |