C35H38O7S2 — CID 71661661
(6R,7R)-8,8-bis(benzenesulfonyl)-6-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-5-oxatricyclo[8.4.0.03,7]tetradeca-1(14),2,10,12-tetraen-4-one (PubChem CID 71661661) has the molecular formula C35H38O7S2 and a molecular weight of 634.82 g/mol. Its IUPAC name is (6R,7R)-8,8-bis(benzenesulfonyl)-6-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-5-oxatricyclo[8.4.0.03,7]tetradeca-1(14),2,10,12-tetraen-4-one.
| Compound Name | (6R,7R)-8,8-bis(benzenesulfonyl)-6-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-5-oxatricyclo[8.4.0.03,7]tetradeca-1(14),2,10,12-tetraen-4-one |
|---|---|
| PubChem CID | 71661661 |
| Molecular Formula | C35H38O7S2 |
| Molecular Weight | 634.82 g/mol |
| Exact Mass | 634.21 |
| IUPAC Name | (6R,7R)-8,8-bis(benzenesulfonyl)-6-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-5-oxatricyclo[8.4.0.03,7]tetradeca-1(14),2,10,12-tetraen-4-one |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1O[C@@H]1OC(=O)C2=Cc3ccccc3CC(S(=O)(=O)c3ccccc3)(S(=O)(=O)c3ccccc3)[C@H]21 |
| InChI | InChI=1S/C35H38O7S2/c1-23(2)29-19-18-24(3)20-31(29)41-34-32-30(33(36)42-34)21-25-12-10-11-13-26(25)22-35(32,43(37,38)27-14-6-4-7-15-27)44(39,40)28-16-8-5-9-17-28/h4-17,21,23-24,29,31-32,34H,18-20,22H2,1-3H3/t24-,29+,31-,32-,34-/m1/s1 |
| InChIKey | CZGJYKMOVKGWIL-FWCFTXTGSA-N |
| XLogP | 6.25 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.82 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |