C31H38O7S2 — CID 71661473
(3R,3aR)-4,4-bis(benzenesulfonyl)-3-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-3a,5,6,7-tetrahydro-3H-cyclohepta[c]furan-1-one (PubChem CID 71661473) has the molecular formula C31H38O7S2 and a molecular weight of 586.77 g/mol. Its IUPAC name is (3R,3aR)-4,4-bis(benzenesulfonyl)-3-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-3a,5,6,7-tetrahydro-3H-cyclohepta[c]furan-1-one.
| Compound Name | (3R,3aR)-4,4-bis(benzenesulfonyl)-3-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-3a,5,6,7-tetrahydro-3H-cyclohepta[c]furan-1-one |
|---|---|
| PubChem CID | 71661473 |
| Molecular Formula | C31H38O7S2 |
| Molecular Weight | 586.77 g/mol |
| Exact Mass | 586.21 |
| IUPAC Name | (3R,3aR)-4,4-bis(benzenesulfonyl)-3-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-3a,5,6,7-tetrahydro-3H-cyclohepta[c]furan-1-one |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1O[C@@H]1OC(=O)C2=CCCCC(S(=O)(=O)c3ccccc3)(S(=O)(=O)c3ccccc3)[C@H]21 |
| InChI | InChI=1S/C31H38O7S2/c1-21(2)25-18-17-22(3)20-27(25)37-30-28-26(29(32)38-30)16-10-11-19-31(28,39(33,34)23-12-6-4-7-13-23)40(35,36)24-14-8-5-9-15-24/h4-9,12-16,21-22,25,27-28,30H,10-11,17-20H2,1-3H3/t22-,25+,27-,28-,30-/m1/s1 |
| InChIKey | JZWDHJUOQLVASS-ADCJMZFCSA-N |
| XLogP | 5.72 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.77 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |