C34H40O3S2 — CID 10370580
(3R,4R,5R)-3-methyl-5-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-4-[phenyl-bis(phenylsulfanyl)methyl]oxolan-2-one (PubChem CID 10370580) has the molecular formula C34H40O3S2 and a molecular weight of 560.83 g/mol. Its IUPAC name is (3R,4R,5R)-3-methyl-5-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-4-[phenyl-bis(phenylsulfanyl)methyl]oxolan-2-one.
| Compound Name | (3R,4R,5R)-3-methyl-5-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-4-[phenyl-bis(phenylsulfanyl)methyl]oxolan-2-one |
|---|---|
| PubChem CID | 10370580 |
| Molecular Formula | C34H40O3S2 |
| Molecular Weight | 560.83 g/mol |
| Exact Mass | 560.24 |
| IUPAC Name | (3R,4R,5R)-3-methyl-5-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-4-[phenyl-bis(phenylsulfanyl)methyl]oxolan-2-one |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1O[C@@H]1OC(=O)[C@H](C)[C@H]1C(Sc1ccccc1)(Sc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H40O3S2/c1-23(2)29-21-20-24(3)22-30(29)36-33-31(25(4)32(35)37-33)34(26-14-8-5-9-15-26,38-27-16-10-6-11-17-27)39-28-18-12-7-13-19-28/h5-19,23-25,29-31,33H,20-22H2,1-4H3/t24-,25-,29+,30-,31-,33-/m1/s1 |
| InChIKey | USWMLUIBFCCVKQ-CZWNIGETSA-N |
| XLogP | 9.04 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.83 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|