C21H30O3S — CID 591240
3-methyl-5-(5-methyl-2-propan-2-ylcyclohexyl)oxy-4-phenylsulfanyloxolan-2-one (PubChem CID 591240) has the molecular formula C21H30O3S and a molecular weight of 362.54 g/mol. Its IUPAC name is 3-methyl-5-(5-methyl-2-propan-2-ylcyclohexyl)oxy-4-phenylsulfanyloxolan-2-one.
| Compound Name | 3-methyl-5-(5-methyl-2-propan-2-ylcyclohexyl)oxy-4-phenylsulfanyloxolan-2-one |
|---|---|
| PubChem CID | 591240 |
| Molecular Formula | C21H30O3S |
| Molecular Weight | 362.54 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | 3-methyl-5-(5-methyl-2-propan-2-ylcyclohexyl)oxy-4-phenylsulfanyloxolan-2-one |
| SMILES | CC1CCC(C(C)C)C(OC2OC(=O)C(C)C2Sc2ccccc2)C1 |
| InChI | InChI=1S/C21H30O3S/c1-13(2)17-11-10-14(3)12-18(17)23-21-19(15(4)20(22)24-21)25-16-8-6-5-7-9-16/h5-9,13-15,17-19,21H,10-12H2,1-4H3 |
| InChIKey | OJGBHGKXKZNBFW-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.54 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |