C20H28O3Se — CID 57382026
(3R,5R)-5-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-3-phenylselanyloxolan-2-one (PubChem CID 57382026) has the molecular formula C20H28O3Se and a molecular weight of 395.40 g/mol. Its IUPAC name is (3R,5R)-5-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-3-phenylselanyloxolan-2-one.
| Compound Name | (3R,5R)-5-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-3-phenylselanyloxolan-2-one |
|---|---|
| PubChem CID | 57382026 |
| Molecular Formula | C20H28O3Se |
| Molecular Weight | 395.40 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | (3R,5R)-5-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-3-phenylselanyloxolan-2-one |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1O[C@H]1C[C@@H]([Se]c2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C20H28O3Se/c1-13(2)16-10-9-14(3)11-17(16)22-19-12-18(20(21)23-19)24-15-7-5-4-6-8-15/h4-8,13-14,16-19H,9-12H2,1-3H3/t14-,16+,17-,18-,19-/m1/s1 |
| InChIKey | UOXMTMMXCLRSCJ-RSRPTUBKSA-N |
| XLogP | 3.56 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.40 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|