C40H56O6Se2 — CID 139092226
(3R,5R)-5-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-3-phenylselanyloxolan-2-one (PubChem CID 139092226) has the molecular formula C40H56O6Se2 and a molecular weight of 790.80 g/mol. Its IUPAC name is (3R,5R)-5-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-3-phenylselanyloxolan-2-one.
| Compound Name | (3R,5R)-5-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-3-phenylselanyloxolan-2-one |
|---|---|
| PubChem CID | 139092226 |
| Molecular Formula | C40H56O6Se2 |
| Molecular Weight | 790.80 g/mol |
| Exact Mass | 792.24 |
| IUPAC Name | (3R,5R)-5-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-3-phenylselanyloxolan-2-one |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1O[C@H]1C[C@@H]([Se]c2ccccc2)C(=O)O1.CC(C)[C@@H]1CC[C@@H](C)C[C@H]1O[C@H]1C[C@@H]([Se]c2ccccc2)C(=O)O1 |
| InChI | InChI=1S/2C20H28O3Se/c2*1-13(2)16-10-9-14(3)11-17(16)22-19-12-18(20(21)23-19)24-15-7-5-4-6-8-15/h2*4-8,13-14,16-19H,9-12H2,1-3H3/t2*14-,16+,17-,18-,19-/m11/s1 |
| InChIKey | QPAYPAGBSFRMRB-RQVPHPEESA-N |
| XLogP | 7.11 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.80 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|