C38H58O4Si — CID 11180998
(4R,5R)-4-[8-[tert-butyl(diphenyl)silyl]oxyoctyl]-5-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyoxolan-2-one (PubChem CID 11180998) has the molecular formula C38H58O4Si and a molecular weight of 606.96 g/mol. Its IUPAC name is (4R,5R)-4-[8-[tert-butyl(diphenyl)silyl]oxyoctyl]-5-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyoxolan-2-one.
| Compound Name | (4R,5R)-4-[8-[tert-butyl(diphenyl)silyl]oxyoctyl]-5-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyoxolan-2-one |
|---|---|
| PubChem CID | 11180998 |
| Molecular Formula | C38H58O4Si |
| Molecular Weight | 606.96 g/mol |
| Exact Mass | 606.41 |
| IUPAC Name | (4R,5R)-4-[8-[tert-butyl(diphenyl)silyl]oxyoctyl]-5-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyoxolan-2-one |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1O[C@@H]1OC(=O)C[C@H]1CCCCCCCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C38H58O4Si/c1-29(2)34-25-24-30(3)27-35(34)41-37-31(28-36(39)42-37)19-13-9-7-8-10-18-26-40-43(38(4,5)6,32-20-14-11-15-21-32)33-22-16-12-17-23-33/h11-12,14-17,20-23,29-31,34-35,37H,7-10,13,18-19,24-28H2,1-6H3/t30-,31-,34+,35-,37-/m1/s1 |
| InChIKey | RJNAHYDCURWBMO-RRNWTFPCSA-N |
| XLogP | 8.66 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.96 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|