C43H66O4Si — CID 11227693
(3R,4R,5R)-4-[8-[tert-butyl(diphenyl)silyl]oxyoctyl]-5-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-3-[(Z)-pent-2-enyl]oxolan-2-one (PubChem CID 11227693) has the molecular formula C43H66O4Si and a molecular weight of 675.08 g/mol. Its IUPAC name is (3R,4R,5R)-4-[8-[tert-butyl(diphenyl)silyl]oxyoctyl]-5-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-3-[(Z)-pent-2-enyl]oxolan-2-one.
| Compound Name | (3R,4R,5R)-4-[8-[tert-butyl(diphenyl)silyl]oxyoctyl]-5-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-3-[(Z)-pent-2-enyl]oxolan-2-one |
|---|---|
| PubChem CID | 11227693 |
| Molecular Formula | C43H66O4Si |
| Molecular Weight | 675.08 g/mol |
| Exact Mass | 674.47 |
| IUPAC Name | (3R,4R,5R)-4-[8-[tert-butyl(diphenyl)silyl]oxyoctyl]-5-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-3-[(Z)-pent-2-enyl]oxolan-2-one |
| SMILES | CC/C=C\C[C@H]1C(=O)O[C@@H](O[C@@H]2C[C@H](C)CC[C@H]2C(C)C)[C@@H]1CCCCCCCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C43H66O4Si/c1-8-9-16-27-38-39(42(47-41(38)44)46-40-32-34(4)29-30-37(40)33(2)3)28-21-12-10-11-13-22-31-45-48(43(5,6)7,35-23-17-14-18-24-35)36-25-19-15-20-26-36/h9,14-20,23-26,33-34,37-40,42H,8,10-13,21-22,27-32H2,1-7H3/b16-9-/t34-,37+,38-,39-,40-,42-/m1/s1 |
| InChIKey | CIALYZCDNFEUHP-TYTSWYPWSA-N |
| XLogP | 10.24 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.08 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|