C25H38O2S — CID 142199644
3,7-dimethyl-2-[[4-(phenylsulfanylmethyl)cyclohexyl]methoxy]bicyclo[3.3.1]nonan-2-ol (PubChem CID 142199644) has the molecular formula C25H38O2S and a molecular weight of 402.64 g/mol. Its IUPAC name is 3,7-dimethyl-2-[[4-(phenylsulfanylmethyl)cyclohexyl]methoxy]bicyclo[3.3.1]nonan-2-ol.
| Compound Name | 3,7-dimethyl-2-[[4-(phenylsulfanylmethyl)cyclohexyl]methoxy]bicyclo[3.3.1]nonan-2-ol |
|---|---|
| PubChem CID | 142199644 |
| Molecular Formula | C25H38O2S |
| Molecular Weight | 402.64 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | 3,7-dimethyl-2-[[4-(phenylsulfanylmethyl)cyclohexyl]methoxy]bicyclo[3.3.1]nonan-2-ol |
| SMILES | CC1CC2CC(C)C(O)(OCC3CCC(CSc4ccccc4)CC3)C(C1)C2 |
| InChI | InChI=1S/C25H38O2S/c1-18-12-22-14-19(2)25(26,23(13-18)15-22)27-16-20-8-10-21(11-9-20)17-28-24-6-4-3-5-7-24/h3-7,18-23,26H,8-17H2,1-2H3 |
| InChIKey | XUZXUCKKUMFFCF-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.64 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|