C29H48O2S — CID 140529982
4-[4-[4-(5-phenylsulfanylpentan-2-yloxy)cyclohexyl]hexan-2-yl]cyclohexan-1-ol (PubChem CID 140529982) has the molecular formula C29H48O2S and a molecular weight of 460.77 g/mol. Its IUPAC name is 4-[4-[4-(5-phenylsulfanylpentan-2-yloxy)cyclohexyl]hexan-2-yl]cyclohexan-1-ol.
| Compound Name | 4-[4-[4-(5-phenylsulfanylpentan-2-yloxy)cyclohexyl]hexan-2-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 140529982 |
| Molecular Formula | C29H48O2S |
| Molecular Weight | 460.77 g/mol |
| Exact Mass | 460.34 |
| IUPAC Name | 4-[4-[4-(5-phenylsulfanylpentan-2-yloxy)cyclohexyl]hexan-2-yl]cyclohexan-1-ol |
| SMILES | CCC(CC(C)C1CCC(O)CC1)C1CCC(OC(C)CCCSc2ccccc2)CC1 |
| InChI | InChI=1S/C29H48O2S/c1-4-24(21-22(2)25-12-16-27(30)17-13-25)26-14-18-28(19-15-26)31-23(3)9-8-20-32-29-10-6-5-7-11-29/h5-7,10-11,22-28,30H,4,8-9,12-21H2,1-3H3 |
| InChIKey | YGSFVHKPOYHMFX-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.77 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|