C22H32O2S — CID 11046615
(1R,4S,8R,9S,10R,12R)-9,10,12-trimethyl-9-(2-phenylsulfanylethyl)-2-oxatricyclo[6.3.1.04,12]dodecan-1-ol (PubChem CID 11046615) has the molecular formula C22H32O2S and a molecular weight of 360.56 g/mol. Its IUPAC name is (1R,4S,8R,9S,10R,12R)-9,10,12-trimethyl-9-(2-phenylsulfanylethyl)-2-oxatricyclo[6.3.1.04,12]dodecan-1-ol.
| Compound Name | (1R,4S,8R,9S,10R,12R)-9,10,12-trimethyl-9-(2-phenylsulfanylethyl)-2-oxatricyclo[6.3.1.04,12]dodecan-1-ol |
|---|---|
| PubChem CID | 11046615 |
| Molecular Formula | C22H32O2S |
| Molecular Weight | 360.56 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | (1R,4S,8R,9S,10R,12R)-9,10,12-trimethyl-9-(2-phenylsulfanylethyl)-2-oxatricyclo[6.3.1.04,12]dodecan-1-ol |
| SMILES | C[C@@H]1C[C@@]2(O)OC[C@H]3CCC[C@H]([C@@]1(C)CCSc1ccccc1)[C@]32C |
| InChI | InChI=1S/C22H32O2S/c1-16-14-22(23)21(3)17(15-24-22)8-7-11-19(21)20(16,2)12-13-25-18-9-5-4-6-10-18/h4-6,9-10,16-17,19,23H,7-8,11-15H2,1-3H3/t16-,17-,19-,20+,21+,22-/m1/s1 |
| InChIKey | HNHQKAYUBNCSLX-KTPWBMAYSA-N |
| XLogP | 5.36 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.56 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |