C32H50O3S — CID 10673386
(1S,2R,4S,7R,10S,11S,14R,15R)-2,15-dimethyl-14-[(2R)-6-methylheptan-2-yl]-4-(phenylsulfanylmethyl)-5,6-dioxatetracyclo[8.7.0.02,7.011,15]heptadecan-7-ol (PubChem CID 10673386) has the molecular formula C32H50O3S and a molecular weight of 514.82 g/mol. Its IUPAC name is (1S,2R,4S,7R,10S,11S,14R,15R)-2,15-dimethyl-14-[(2R)-6-methylheptan-2-yl]-4-(phenylsulfanylmethyl)-5,6-dioxatetracyclo[8.7.0.02,7.011,15]heptadecan-7-ol.
| Compound Name | (1S,2R,4S,7R,10S,11S,14R,15R)-2,15-dimethyl-14-[(2R)-6-methylheptan-2-yl]-4-(phenylsulfanylmethyl)-5,6-dioxatetracyclo[8.7.0.02,7.011,15]heptadecan-7-ol |
|---|---|
| PubChem CID | 10673386 |
| Molecular Formula | C32H50O3S |
| Molecular Weight | 514.82 g/mol |
| Exact Mass | 514.35 |
| IUPAC Name | (1S,2R,4S,7R,10S,11S,14R,15R)-2,15-dimethyl-14-[(2R)-6-methylheptan-2-yl]-4-(phenylsulfanylmethyl)-5,6-dioxatetracyclo[8.7.0.02,7.011,15]heptadecan-7-ol |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC[C@@]4(O)OO[C@H](CSc5ccccc5)C[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C32H50O3S/c1-22(2)10-9-11-23(3)27-14-15-28-26-16-19-32(33)31(5,29(26)17-18-30(27,28)4)20-24(34-35-32)21-36-25-12-7-6-8-13-25/h6-8,12-13,22-24,26-29,33H,9-11,14-21H2,1-5H3/t23-,24+,26+,27-,28+,29+,30-,31-,32-/m1/s1 |
| InChIKey | FILBBAADQMLVCI-ZLZYGBGPSA-N |
| XLogP | 8.51 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.82 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|