C36H56O3S — CID 10507247
(1S,2S,5R,6R,9S,10R,13S,15R,18S,20S)-1,5-dimethyl-6-[(2R)-6-methylheptan-2-yl]-18-(phenylsulfanylmethyl)-16,17-dioxapentacyclo[11.8.0.02,10.05,9.015,20]henicosan-15-ol (PubChem CID 10507247) has the molecular formula C36H56O3S and a molecular weight of 568.91 g/mol. Its IUPAC name is (1S,2S,5R,6R,9S,10R,13S,15R,18S,20S)-1,5-dimethyl-6-[(2R)-6-methylheptan-2-yl]-18-(phenylsulfanylmethyl)-16,17-dioxapentacyclo[11.8.0.02,10.05,9.015,20]henicosan-15-ol.
| Compound Name | (1S,2S,5R,6R,9S,10R,13S,15R,18S,20S)-1,5-dimethyl-6-[(2R)-6-methylheptan-2-yl]-18-(phenylsulfanylmethyl)-16,17-dioxapentacyclo[11.8.0.02,10.05,9.015,20]henicosan-15-ol |
|---|---|
| PubChem CID | 10507247 |
| Molecular Formula | C36H56O3S |
| Molecular Weight | 568.91 g/mol |
| Exact Mass | 568.40 |
| IUPAC Name | (1S,2S,5R,6R,9S,10R,13S,15R,18S,20S)-1,5-dimethyl-6-[(2R)-6-methylheptan-2-yl]-18-(phenylsulfanylmethyl)-16,17-dioxapentacyclo[11.8.0.02,10.05,9.015,20]henicosan-15-ol |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC[C@H]4C[C@@]5(O)OO[C@H](CSc6ccccc6)C[C@@H]5C[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C36H56O3S/c1-24(2)10-9-11-25(3)31-16-17-32-30-15-14-26-22-36(37)27(21-35(26,5)33(30)18-19-34(31,32)4)20-28(38-39-36)23-40-29-12-7-6-8-13-29/h6-8,12-13,24-28,30-33,37H,9-11,14-23H2,1-5H3/t25-,26+,27-,28+,30+,31-,32+,33+,34-,35+,36-/m1/s1 |
| InChIKey | FBDJLUJOVXTLTK-DEQUBPKNSA-N |
| XLogP | 9.54 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.91 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|