C28H46O3S — CID 58789618
4-[4-[4-[1-(2-phenylsulfanylethoxy)ethoxy]cyclohexyl]hexan-2-yl]cyclohexan-1-ol (PubChem CID 58789618) has the molecular formula C28H46O3S and a molecular weight of 462.74 g/mol. Its IUPAC name is 4-[4-[4-[1-(2-phenylsulfanylethoxy)ethoxy]cyclohexyl]hexan-2-yl]cyclohexan-1-ol.
| Compound Name | 4-[4-[4-[1-(2-phenylsulfanylethoxy)ethoxy]cyclohexyl]hexan-2-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 58789618 |
| Molecular Formula | C28H46O3S |
| Molecular Weight | 462.74 g/mol |
| Exact Mass | 462.32 |
| IUPAC Name | 4-[4-[4-[1-(2-phenylsulfanylethoxy)ethoxy]cyclohexyl]hexan-2-yl]cyclohexan-1-ol |
| SMILES | CCC(CC(C)C1CCC(O)CC1)C1CCC(OC(C)OCCSc2ccccc2)CC1 |
| InChI | InChI=1S/C28H46O3S/c1-4-23(20-21(2)24-10-14-26(29)15-11-24)25-12-16-27(17-13-25)31-22(3)30-18-19-32-28-8-6-5-7-9-28/h5-9,21-27,29H,4,10-20H2,1-3H3 |
| InChIKey | ZSOZZEKAHUCTJM-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.74 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|