C28H34O4S2 — CID 157196374
(5-methyl-2-propan-2-ylcyclohexyl) sulfate;triphenylsulfanium (PubChem CID 157196374) has the molecular formula C28H34O4S2 and a molecular weight of 498.71 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl) sulfate;triphenylsulfanium.
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl) sulfate;triphenylsulfanium |
|---|---|
| PubChem CID | 157196374 |
| Molecular Formula | C28H34O4S2 |
| Molecular Weight | 498.71 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl) sulfate;triphenylsulfanium |
| SMILES | CC1CCC(C(C)C)C(OS(=O)(=O)[O-])C1.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C10H20O4S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-7(2)9-5-4-8(3)6-10(9)14-15(11,12)13/h1-15H;7-10H,4-6H2,1-3H3,(H,11,12,13)/q+1;/p-1 |
| InChIKey | AQHITEVBWJGUCS-UHFFFAOYSA-M |
| XLogP | 6.71 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.71 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|