C39H54O4S2 — CID 139057968
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] [2-[(1S,2S)-2-[2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxycarbonylsulfanylphenyl]cyclopentyl]phenyl]sulfanylformate (PubChem CID 139057968) has the molecular formula C39H54O4S2 and a molecular weight of 650.99 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] [2-[(1S,2S)-2-[2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxycarbonylsulfanylphenyl]cyclopentyl]phenyl]sulfanylformate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] [2-[(1S,2S)-2-[2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxycarbonylsulfanylphenyl]cyclopentyl]phenyl]sulfanylformate |
|---|---|
| PubChem CID | 139057968 |
| Molecular Formula | C39H54O4S2 |
| Molecular Weight | 650.99 g/mol |
| Exact Mass | 650.35 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] [2-[(1S,2S)-2-[2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxycarbonylsulfanylphenyl]cyclopentyl]phenyl]sulfanylformate |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1OC(=O)Sc1ccccc1[C@H]1CCC[C@@H]1c1ccccc1SC(=O)O[C@@H]1C[C@H](C)CC[C@H]1C(C)C |
| InChI | InChI=1S/C39H54O4S2/c1-24(2)28-20-18-26(5)22-34(28)42-38(40)44-36-16-9-7-12-32(36)30-14-11-15-31(30)33-13-8-10-17-37(33)45-39(41)43-35-23-27(6)19-21-29(35)25(3)4/h7-10,12-13,16-17,24-31,34-35H,11,14-15,18-23H2,1-6H3/t26-,27-,28+,29+,30+,31+,34-,35-/m1/s1 |
| InChIKey | DGSKLEPUGBPBHS-KMBJLPGJSA-N |
| XLogP | 12.12 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.99 |
| LogP ≤ 5 | 12.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|