C42H50O4S2 — CID 10818342
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] [1-[2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxycarbonylsulfanylnaphthalen-1-yl]naphthalen-2-yl]sulfanylformate (PubChem CID 10818342) has the molecular formula C42H50O4S2 and a molecular weight of 682.99 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] [1-[2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxycarbonylsulfanylnaphthalen-1-yl]naphthalen-2-yl]sulfanylformate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] [1-[2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxycarbonylsulfanylnaphthalen-1-yl]naphthalen-2-yl]sulfanylformate |
|---|---|
| PubChem CID | 10818342 |
| Molecular Formula | C42H50O4S2 |
| Molecular Weight | 682.99 g/mol |
| Exact Mass | 682.32 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] [1-[2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxycarbonylsulfanylnaphthalen-1-yl]naphthalen-2-yl]sulfanylformate |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1OC(=O)Sc1ccc2ccccc2c1-c1c(SC(=O)O[C@@H]2C[C@H](C)CC[C@H]2C(C)C)ccc2ccccc12 |
| InChI | InChI=1S/C42H50O4S2/c1-25(2)31-19-15-27(5)23-35(31)45-41(43)47-37-21-17-29-11-7-9-13-33(29)39(37)40-34-14-10-8-12-30(34)18-22-38(40)48-42(44)46-36-24-28(6)16-20-32(36)26(3)4/h7-14,17-18,21-22,25-28,31-32,35-36H,15-16,19-20,23-24H2,1-6H3/t27-,28-,31+,32+,35-,36-/m1/s1 |
| InChIKey | JJPBXNXDDRVIDH-IIQCZUBLSA-N |
| XLogP | 13.04 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.99 |
| LogP ≤ 5 | 13.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|