C45H54O4S2+2 — CID 163490091
2-adamantyl 3-[4-(thiolan-1-ium-1-yl)naphthalen-1-yl]propanoate;methyl 3-[4-(thiolan-1-ium-1-yl)naphthalen-1-yl]propanoate (PubChem CID 163490091) has the molecular formula C45H54O4S2+2 and a molecular weight of 723.06 g/mol. Its IUPAC name is 2-adamantyl 3-[4-(thiolan-1-ium-1-yl)naphthalen-1-yl]propanoate;methyl 3-[4-(thiolan-1-ium-1-yl)naphthalen-1-yl]propanoate.
| Compound Name | 2-adamantyl 3-[4-(thiolan-1-ium-1-yl)naphthalen-1-yl]propanoate;methyl 3-[4-(thiolan-1-ium-1-yl)naphthalen-1-yl]propanoate |
|---|---|
| PubChem CID | 163490091 |
| Molecular Formula | C45H54O4S2+2 |
| Molecular Weight | 723.06 g/mol |
| Exact Mass | 722.35 |
| IUPAC Name | 2-adamantyl 3-[4-(thiolan-1-ium-1-yl)naphthalen-1-yl]propanoate;methyl 3-[4-(thiolan-1-ium-1-yl)naphthalen-1-yl]propanoate |
| SMILES | COC(=O)CCc1ccc([S+]2CCCC2)c2ccccc12.O=C(CCc1ccc([S+]2CCCC2)c2ccccc12)OC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C27H33O2S.C18H21O2S/c28-26(29-27-21-14-18-13-19(16-21)17-22(27)15-18)10-8-20-7-9-25(30-11-3-4-12-30)24-6-2-1-5-23(20)24;1-20-18(19)11-9-14-8-10-17(21-12-4-5-13-21)16-7-3-2-6-15(14)16/h1-2,5-7,9,18-19,21-22,27H,3-4,8,10-17H2;2-3,6-8,10H,4-5,9,11-13H2,1H3/q2*+1 |
| InChIKey | CLVVWUBNWOLZNK-UHFFFAOYSA-N |
| XLogP | 9.63 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.06 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|