C30H33F2O3S2+ — CID 161046822
2-adamantyl 1,1-difluoroethanesulfonate;triphenylsulfanium (PubChem CID 161046822) has the molecular formula C30H33F2O3S2+ and a molecular weight of 543.72 g/mol. Its IUPAC name is 2-adamantyl 1,1-difluoroethanesulfonate;triphenylsulfanium.
| Compound Name | 2-adamantyl 1,1-difluoroethanesulfonate;triphenylsulfanium |
|---|---|
| PubChem CID | 161046822 |
| Molecular Formula | C30H33F2O3S2+ |
| Molecular Weight | 543.72 g/mol |
| Exact Mass | 543.18 |
| IUPAC Name | 2-adamantyl 1,1-difluoroethanesulfonate;triphenylsulfanium |
| SMILES | CC(F)(F)S(=O)(=O)OC1C2CC3CC(C2)CC1C3.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C12H18F2O3S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-12(13,14)18(15,16)17-11-9-3-7-2-8(5-9)6-10(11)4-7/h1-15H;7-11H,2-6H2,1H3/q+1; |
| InChIKey | UBPJBKHCABUPLO-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.72 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|