C24H30O3S — CID 10572967
[(Z)-1-(benzenesulfonyl)-2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyethenyl]benzene (PubChem CID 10572967) has the molecular formula C24H30O3S and a molecular weight of 398.57 g/mol. Its IUPAC name is [(Z)-1-(benzenesulfonyl)-2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyethenyl]benzene.
| Compound Name | [(Z)-1-(benzenesulfonyl)-2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyethenyl]benzene |
|---|---|
| PubChem CID | 10572967 |
| Molecular Formula | C24H30O3S |
| Molecular Weight | 398.57 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | [(Z)-1-(benzenesulfonyl)-2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyethenyl]benzene |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1O/C=C(/c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H30O3S/c1-18(2)22-15-14-19(3)16-23(22)27-17-24(20-10-6-4-7-11-20)28(25,26)21-12-8-5-9-13-21/h4-13,17-19,22-23H,14-16H2,1-3H3/b24-17-/t19-,22+,23-/m1/s1 |
| InChIKey | MSYSVPSAHZKALX-WWFIDFIQSA-N |
| XLogP | 5.94 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.57 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|