C16H24O2S — CID 15627224
3-[1-methoxy-2-(4-methylphenyl)sulfanylpropyl]oxane (PubChem CID 15627224) has the molecular formula C16H24O2S and a molecular weight of 280.43 g/mol. Its IUPAC name is 3-[1-methoxy-2-(4-methylphenyl)sulfanylpropyl]oxane.
| Compound Name | 3-[1-methoxy-2-(4-methylphenyl)sulfanylpropyl]oxane |
|---|---|
| PubChem CID | 15627224 |
| Molecular Formula | C16H24O2S |
| Molecular Weight | 280.43 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 3-[1-methoxy-2-(4-methylphenyl)sulfanylpropyl]oxane |
| SMILES | COC(C1CCCOC1)C(C)Sc1ccc(C)cc1 |
| InChI | InChI=1S/C16H24O2S/c1-12-6-8-15(9-7-12)19-13(2)16(17-3)14-5-4-10-18-11-14/h6-9,13-14,16H,4-5,10-11H2,1-3H3 |
| InChIKey | UVZJLAPADSGQIV-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.43 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |