C19H30O2S — CID 11034636
(2S,4S)-4-hexyl-6-phenylsulfanyl-2-propan-2-yl-1,3-dioxane (PubChem CID 11034636) has the molecular formula C19H30O2S and a molecular weight of 322.51 g/mol. Its IUPAC name is (2S,4S)-4-hexyl-6-phenylsulfanyl-2-propan-2-yl-1,3-dioxane.
| Compound Name | (2S,4S)-4-hexyl-6-phenylsulfanyl-2-propan-2-yl-1,3-dioxane |
|---|---|
| PubChem CID | 11034636 |
| Molecular Formula | C19H30O2S |
| Molecular Weight | 322.51 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | (2S,4S)-4-hexyl-6-phenylsulfanyl-2-propan-2-yl-1,3-dioxane |
| SMILES | CCCCCC[C@H]1CC(Sc2ccccc2)O[C@@H](C(C)C)O1 |
| InChI | InChI=1S/C19H30O2S/c1-4-5-6-8-11-16-14-18(21-19(20-16)15(2)3)22-17-12-9-7-10-13-17/h7,9-10,12-13,15-16,18-19H,4-6,8,11,14H2,1-3H3/t16-,18?,19-/m0/s1 |
| InChIKey | JKKCWPNFPRWGRN-NMBLWERJSA-N |
| XLogP | 5.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.51 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|