C15H20O3S — CID 135049708
(2S,4S,5S)-4-(benzenesulfinyl)-2-methyl-1,10-dioxaspiro[4.5]decane (PubChem CID 135049708) has the molecular formula C15H20O3S and a molecular weight of 280.39 g/mol. Its IUPAC name is (2S,4S,5S)-4-(benzenesulfinyl)-2-methyl-1,10-dioxaspiro[4.5]decane.
| Compound Name | (2S,4S,5S)-4-(benzenesulfinyl)-2-methyl-1,10-dioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 135049708 |
| Molecular Formula | C15H20O3S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | (2S,4S,5S)-4-(benzenesulfinyl)-2-methyl-1,10-dioxaspiro[4.5]decane |
| SMILES | C[C@H]1C[C@H](S(=O)c2ccccc2)[C@]2(CCCCO2)O1 |
| InChI | InChI=1S/C15H20O3S/c1-12-11-14(15(18-12)9-5-6-10-17-15)19(16)13-7-3-2-4-8-13/h2-4,7-8,12,14H,5-6,9-11H2,1H3/t12-,14-,15-,19?/m0/s1 |
| InChIKey | WBKAXLABWBWQFC-FYJDTYRHSA-N |
| XLogP | 2.87 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |