C16H22O4S — CID 134936612
(5S,6S)-5-(4-methylphenyl)sulfonyl-1,7-dioxaspiro[5.5]undecane (PubChem CID 134936612) has the molecular formula C16H22O4S and a molecular weight of 310.41 g/mol. Its IUPAC name is (5S,6S)-5-(4-methylphenyl)sulfonyl-1,7-dioxaspiro[5.5]undecane.
| Compound Name | (5S,6S)-5-(4-methylphenyl)sulfonyl-1,7-dioxaspiro[5.5]undecane |
|---|---|
| PubChem CID | 134936612 |
| Molecular Formula | C16H22O4S |
| Molecular Weight | 310.41 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | (5S,6S)-5-(4-methylphenyl)sulfonyl-1,7-dioxaspiro[5.5]undecane |
| SMILES | Cc1ccc(S(=O)(=O)[C@H]2CCCO[C@@]23CCCCO3)cc1 |
| InChI | InChI=1S/C16H22O4S/c1-13-6-8-14(9-7-13)21(17,18)15-5-4-12-20-16(15)10-2-3-11-19-16/h6-9,15H,2-5,10-12H2,1H3/t15-,16-/m0/s1 |
| InChIKey | ZQQPCZYKPLJYIY-HOTGVXAUSA-N |
| XLogP | 2.84 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.41 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |