C19H22F2O4S — CID 142260279
4-(2,5-difluorophenyl)-2-ethoxy-4-(4-methylphenyl)sulfonylbutan-2-ol (PubChem CID 142260279) has the molecular formula C19H22F2O4S and a molecular weight of 384.44 g/mol. Its IUPAC name is 4-(2,5-difluorophenyl)-2-ethoxy-4-(4-methylphenyl)sulfonylbutan-2-ol.
| Compound Name | 4-(2,5-difluorophenyl)-2-ethoxy-4-(4-methylphenyl)sulfonylbutan-2-ol |
|---|---|
| PubChem CID | 142260279 |
| Molecular Formula | C19H22F2O4S |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 4-(2,5-difluorophenyl)-2-ethoxy-4-(4-methylphenyl)sulfonylbutan-2-ol |
| SMILES | CCOC(C)(O)CC(c1cc(F)ccc1F)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H22F2O4S/c1-4-25-19(3,22)12-18(16-11-14(20)7-10-17(16)21)26(23,24)15-8-5-13(2)6-9-15/h5-11,18,22H,4,12H2,1-3H3 |
| InChIKey | DJRVNXMBZYJDOI-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|